C14H21N3O5 — CID 167860284
2-[[[2-hydroxy-1-(4-methoxyphenyl)ethyl]-methylcarbamoyl]amino]-N-methoxyacetamide (PubChem CID 167860284) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[[[2-hydroxy-1-(4-methoxyphenyl)ethyl]-methylcarbamoyl]amino]-N-methoxyacetamide.
| Compound Name | 2-[[[2-hydroxy-1-(4-methoxyphenyl)ethyl]-methylcarbamoyl]amino]-N-methoxyacetamide |
|---|---|
| PubChem CID | 167860284 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[[[2-hydroxy-1-(4-methoxyphenyl)ethyl]-methylcarbamoyl]amino]-N-methoxyacetamide |
| SMILES | CONC(=O)CNC(=O)N(C)C(CO)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21N3O5/c1-17(14(20)15-8-13(19)16-22-3)12(9-18)10-4-6-11(21-2)7-5-10/h4-7,12,18H,8-9H2,1-3H3,(H,15,20)(H,16,19) |
| InChIKey | WVKGIGDQIJNKLL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|