C12H10F3N3O3 — CID 167860411
1,3-dihydroxy-N-(1,1,1-trifluoropropan-2-ylimino)-2H-isoindole-5-carboxamide (PubChem CID 167860411) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1,3-dihydroxy-N-(1,1,1-trifluoropropan-2-ylimino)-2H-isoindole-5-carboxamide.
| Compound Name | 1,3-dihydroxy-N-(1,1,1-trifluoropropan-2-ylimino)-2H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 167860411 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1,3-dihydroxy-N-(1,1,1-trifluoropropan-2-ylimino)-2H-isoindole-5-carboxamide |
| SMILES | CC(/N=N/C(=O)c1ccc2c(O)[nH]c(O)c2c1)C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O3/c1-5(12(13,14)15)17-18-9(19)6-2-3-7-8(4-6)11(21)16-10(7)20/h2-5,16,20-21H,1H3/b18-17+ |
| InChIKey | VICYMBIVBNARPS-ISLYRVAYSA-N |
| XLogP | 3.12 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|