C18H29N5O2S — CID 167861292
3-cyclobutyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide (PubChem CID 167861292) has the molecular formula C18H29N5O2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 3-cyclobutyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide.
| Compound Name | 3-cyclobutyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 167861292 |
| Molecular Formula | C18H29N5O2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-cyclobutyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-1,4-thiazepane-4-carboxamide |
| SMILES | COCc1nc2n(n1)CC(NC(=O)N1CCCSCC1C1CCC1)CC2 |
| InChI | InChI=1S/C18H29N5O2S/c1-25-11-16-20-17-7-6-14(10-23(17)21-16)19-18(24)22-8-3-9-26-12-15(22)13-4-2-5-13/h13-15H,2-12H2,1H3,(H,19,24) |
| InChIKey | UHLWVFFORVOJIM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |