C18H24N6 — CID 167861635
N-(5,6-dimethyl-2-pyrimidin-2-ylpyrimidin-4-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 167861635) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-(5,6-dimethyl-2-pyrimidin-2-ylpyrimidin-4-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | N-(5,6-dimethyl-2-pyrimidin-2-ylpyrimidin-4-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 167861635 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | N-(5,6-dimethyl-2-pyrimidin-2-ylpyrimidin-4-yl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | Cc1nc(-c2ncccn2)nc(NC2CCC3CN(C)CC32)c1C |
| InChI | InChI=1S/C18H24N6/c1-11-12(2)21-18(17-19-7-4-8-20-17)23-16(11)22-15-6-5-13-9-24(3)10-14(13)15/h4,7-8,13-15H,5-6,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | HACKDQBZLCGHLO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |