C17H20N6O2 — CID 167861725
(2-methoxyphenyl)-[5-(1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridin-6-yl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 167861725) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is (2-methoxyphenyl)-[5-(1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridin-6-yl)-1,2,4-oxadiazol-3-yl]methanamine.
| Compound Name | (2-methoxyphenyl)-[5-(1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridin-6-yl)-1,2,4-oxadiazol-3-yl]methanamine |
|---|---|
| PubChem CID | 167861725 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (2-methoxyphenyl)-[5-(1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-b]pyridin-6-yl)-1,2,4-oxadiazol-3-yl]methanamine |
| SMILES | COc1ccccc1C(N)c1noc(C2CNc3cnn(C)c3C2)n1 |
| InChI | InChI=1S/C17H20N6O2/c1-23-13-7-10(8-19-12(13)9-20-23)17-21-16(22-25-17)15(18)11-5-3-4-6-14(11)24-2/h3-6,9-10,15,19H,7-8,18H2,1-2H3 |
| InChIKey | IPZVKUYIMUPMHX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |