C20H22N4O2S — CID 167862235
4-pyridin-3-yloxy-N-(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl)butanamide (PubChem CID 167862235) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 4-pyridin-3-yloxy-N-(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl)butanamide.
| Compound Name | 4-pyridin-3-yloxy-N-(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl)butanamide |
|---|---|
| PubChem CID | 167862235 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-pyridin-3-yloxy-N-(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl)butanamide |
| SMILES | O=C(CCCOc1cccnc1)Nc1ccc2nc(N3CCCC3)sc2c1 |
| InChI | InChI=1S/C20H22N4O2S/c25-19(6-4-12-26-16-5-3-9-21-14-16)22-15-7-8-17-18(13-15)27-20(23-17)24-10-1-2-11-24/h3,5,7-9,13-14H,1-2,4,6,10-12H2,(H,22,25) |
| InChIKey | DTEJQOXLXVNABT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|