C13H22N2O2S — CID 167863207
(6S)-3-cyclohexyl-6-(2-methylsulfanylethyl)piperazine-2,5-dione (PubChem CID 167863207) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is (6S)-3-cyclohexyl-6-(2-methylsulfanylethyl)piperazine-2,5-dione.
| Compound Name | (6S)-3-cyclohexyl-6-(2-methylsulfanylethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 167863207 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (6S)-3-cyclohexyl-6-(2-methylsulfanylethyl)piperazine-2,5-dione |
| SMILES | CSCC[C@@H]1NC(=O)C(C2CCCCC2)NC1=O |
| InChI | InChI=1S/C13H22N2O2S/c1-18-8-7-10-12(16)15-11(13(17)14-10)9-5-3-2-4-6-9/h9-11H,2-8H2,1H3,(H,14,17)(H,15,16)/t10-,11?/m0/s1 |
| InChIKey | XNBKMHJRNISXBZ-VUWPPUDQSA-N |
| XLogP | 1.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |