C19H19N3O2S — CID 167863589
N-(7-bicyclo[4.1.0]heptanyl)-N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)oxamide (PubChem CID 167863589) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-(7-bicyclo[4.1.0]heptanyl)-N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)oxamide.
| Compound Name | N-(7-bicyclo[4.1.0]heptanyl)-N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 167863589 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(7-bicyclo[4.1.0]heptanyl)-N'-(4H-indeno[1,2-d][1,3]thiazol-2-yl)oxamide |
| SMILES | O=C(Nc1nc2c(s1)Cc1ccccc1-2)C(=O)NC1C2CCCCC21 |
| InChI | InChI=1S/C19H19N3O2S/c23-17(20-15-12-7-3-4-8-13(12)15)18(24)22-19-21-16-11-6-2-1-5-10(11)9-14(16)25-19/h1-2,5-6,12-13,15H,3-4,7-9H2,(H,20,23)(H,21,22,24) |
| InChIKey | DYWUSFATTZTDHK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|