C16H24BrN — CID 167864484
N-[2-(cyclohexen-1-yl)ethyl]-1-phenylethanamine;hydrobromide (PubChem CID 167864484) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-phenylethanamine;hydrobromide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-phenylethanamine;hydrobromide |
|---|---|
| PubChem CID | 167864484 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-phenylethanamine;hydrobromide |
| SMILES | Br.CC(NCCC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H23N.BrH/c1-14(16-10-6-3-7-11-16)17-13-12-15-8-4-2-5-9-15;/h3,6-8,10-11,14,17H,2,4-5,9,12-13H2,1H3;1H |
| InChIKey | MNMLWSQNMFTCII-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|