5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid

C10H7NO4S — CID 16786477

IUPAC5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid
SMILESCc1cc(N2C(=O)C=CC2=O)sc1C(=O)O
InChIInChI=1S/C10H7NO4S/c1-5-4-8(16-9(5)10(14)15)11-6(12)2-3-7(11)13/h2-4H,1H3,(H,14,15)
InChIKeyYOMXDNYYRKYQLQ-UHFFFAOYSA-N
MW237.24 g/mol
LogP1.18
Rot. Bonds2

About 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid

5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid (PubChem CID 16786477) has the molecular formula C10H7NO4S and a molecular weight of 237.24 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid.

Molecular Properties

Compound Name5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid
PubChem CID16786477
Molecular FormulaC10H7NO4S
Molecular Weight237.24 g/mol
Exact Mass237.01
IUPAC Name5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid
SMILESCc1cc(N2C(=O)C=CC2=O)sc1C(=O)O
InChIInChI=1S/C10H7NO4S/c1-5-4-8(16-9(5)10(14)15)11-6(12)2-3-7(11)13/h2-4H,1H3,(H,14,15)
InChIKeyYOMXDNYYRKYQLQ-UHFFFAOYSA-N
XLogP1.18
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.24
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid (CID 16786477) is 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid is Cc1cc(N2C(=O)C=CC2=O)sc1C(=O)O.
What is the InChIKey of 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid?
The InChIKey is YOMXDNYYRKYQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO4S/c1-5-4-8(16-9(5)10(14)15)11-6(12)2-3-7(11)13/h2-4H,1H3,(H,14,15).
What are the key properties of 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid?
5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid has a molecular weight of 237.24 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dioxopyrrol-1-yl)-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 16786477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).