About methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate
methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate (PubChem CID 167865415) has the molecular formula C16H17N5O3
and a molecular weight of 327.34 g/mol. Its IUPAC name is methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate |
| PubChem CID | 167865415 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)Nc2n[nH]c(C)c2C)cc2[nH]ccc12 |
| InChI | InChI=1S/C16H17N5O3/c1-8-9(2)20-21-14(8)19-16(23)18-10-6-12(15(22)24-3)11-4-5-17-13(11)7-10/h4-7,17H,1-3H3,(H3,18,19,20,21,23) |
| InChIKey | KONBERYTPZHQOC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate?
The IUPAC name of methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate (CID 167865415) is methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate.
What is the SMILES notation for methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate?
The canonical SMILES for methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate is COC(=O)c1cc(NC(=O)Nc2n[nH]c(C)c2C)cc2[nH]ccc12.
What is the InChIKey of methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate?
The InChIKey is KONBERYTPZHQOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O3/c1-8-9(2)20-21-14(8)19-16(23)18-10-6-12(15(22)24-3)11-4-5-17-13(11)7-10/h4-7,17H,1-3H3,(H3,18,19,20,21,23).
What are the key properties of methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate?
methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate has a molecular weight of 327.34 g/mol, XLogP of 2.94, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(4,5-dimethyl-1H-pyrazol-3-yl)carbamoylamino]-1H-indole-4-carboxylate is sourced from PubChem (CID 167865415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).