About N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide
N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide (PubChem CID 167865426) has the molecular formula C12H22N4O6S2
and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide.
Molecular Properties
| Compound Name | N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide |
| PubChem CID | 167865426 |
| Molecular Formula | C12H22N4O6S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide |
| SMILES | CCCCCCS(=O)(=O)NNS(=O)(=O)c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H22N4O6S2/c1-4-5-6-7-8-23(19,20)13-14-24(21,22)10-9-15(2)12(18)16(3)11(10)17/h9,13-14H,4-8H2,1-3H3 |
| InChIKey | UHYQWNFOUJJXCP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide?
The IUPAC name of N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide (CID 167865426) is N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide.
What is the SMILES notation for N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide?
The canonical SMILES for N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide is CCCCCCS(=O)(=O)NNS(=O)(=O)c1cn(C)c(=O)n(C)c1=O.
What is the InChIKey of N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide?
The InChIKey is UHYQWNFOUJJXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O6S2/c1-4-5-6-7-8-23(19,20)13-14-24(21,22)10-9-15(2)12(18)16(3)11(10)17/h9,13-14H,4-8H2,1-3H3.
What are the key properties of N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide?
N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide has a molecular weight of 382.46 g/mol, XLogP of -1.22, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexylsulfonyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonohydrazide is sourced from PubChem (CID 167865426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).