C11H9BrFN3O — CID 167865643
2-[(2-bromo-6-fluorophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 167865643) has the molecular formula C11H9BrFN3O and a molecular weight of 298.12 g/mol. Its IUPAC name is 2-[(2-bromo-6-fluorophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 2-[(2-bromo-6-fluorophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167865643 |
| Molecular Formula | C11H9BrFN3O |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-[(2-bromo-6-fluorophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1ccnn1Cc1c(F)cccc1Br |
| InChI | InChI=1S/C11H9BrFN3O/c12-8-2-1-3-9(13)7(8)6-16-10(11(14)17)4-5-15-16/h1-5H,6H2,(H2,14,17) |
| InChIKey | ITUXSTYAVLSSEE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |