About 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid
2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid (PubChem CID 167865875) has the molecular formula C13H17FN2O4S
and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid |
| PubChem CID | 167865875 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(N2C[C@@H](F)C[C@H]2CC(=O)O)nc1 |
| InChI | InChI=1S/C13H17FN2O4S/c1-2-21(19,20)11-3-4-12(15-7-11)16-8-9(14)5-10(16)6-13(17)18/h3-4,7,9-10H,2,5-6,8H2,1H3,(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | QFMBXKFEYVHRHB-UWVGGRQHSA-N |
| XLogP | 1.27 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid?
The IUPAC name of 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid (CID 167865875) is 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid.
What is the SMILES notation for 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid?
The canonical SMILES for 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid is CCS(=O)(=O)c1ccc(N2C[C@@H](F)C[C@H]2CC(=O)O)nc1.
What is the InChIKey of 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid?
The InChIKey is QFMBXKFEYVHRHB-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H17FN2O4S/c1-2-21(19,20)11-3-4-12(15-7-11)16-8-9(14)5-10(16)6-13(17)18/h3-4,7,9-10H,2,5-6,8H2,1H3,(H,17,18)/t9-,10-/m0/s1.
What are the key properties of 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid?
2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid has a molecular weight of 316.35 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4S)-1-(5-ethylsulfonyl-2-pyridinyl)-4-fluoropyrrolidin-2-yl]acetic acid is sourced from PubChem (CID 167865875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).