C17H16F3N3O3 — CID 167866056
2-phenyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 167866056) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2-phenyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-phenyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 167866056 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-phenyl-1-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)NCc2nccn2CC(F)(F)F)CC1c1ccccc1 |
| InChI | InChI=1S/C17H16F3N3O3/c18-17(19,20)10-23-7-6-21-13(23)9-22-14(24)16(15(25)26)8-12(16)11-4-2-1-3-5-11/h1-7,12H,8-10H2,(H,22,24)(H,25,26) |
| InChIKey | CAOPKRCEGZITQC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|