C8H9N3O2S — CID 167866725
3-(1,3-thiazol-5-ylmethyl)-1,3-diazinane-2,4-dione (PubChem CID 167866725) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-ylmethyl)-1,3-diazinane-2,4-dione.
| Compound Name | 3-(1,3-thiazol-5-ylmethyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167866725 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 3-(1,3-thiazol-5-ylmethyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCNC(=O)N1Cc1cncs1 |
| InChI | InChI=1S/C8H9N3O2S/c12-7-1-2-10-8(13)11(7)4-6-3-9-5-14-6/h3,5H,1-2,4H2,(H,10,13) |
| InChIKey | OLDSNESFRBGAJU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |