About 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine
5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 167867015) has the molecular formula C11H7F3N6
and a molecular weight of 280.21 g/mol. Its IUPAC name is 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 167867015 |
| Molecular Formula | C11H7F3N6 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2cnc3[nH]ncc3c2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H7F3N6/c12-11(13,14)8-7(4-17-10(15)19-8)5-1-6-3-18-20-9(6)16-2-5/h1-4H,(H2,15,17,19)(H,16,18,20) |
| InChIKey | TVHHYAUKHJEWDL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine (CID 167867015) is 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine is Nc1ncc(-c2cnc3[nH]ncc3c2)c(C(F)(F)F)n1.
What is the InChIKey of 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is TVHHYAUKHJEWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3N6/c12-11(13,14)8-7(4-17-10(15)19-8)5-1-6-3-18-20-9(6)16-2-5/h1-4H,(H2,15,17,19)(H,16,18,20).
What are the key properties of 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine?
5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 280.21 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrazolo[3,4-b]pyridin-5-yl)-4-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 167867015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).