C20H31N5O7S — CID 167867328
(2E)-2-methoxyimino-N-[6-oxo-6-[2-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]hexyl]sulfonylacetamide (PubChem CID 167867328) has the molecular formula C20H31N5O7S and a molecular weight of 485.56 g/mol. Its IUPAC name is (2E)-2-methoxyimino-N-[6-oxo-6-[2-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]hexyl]sulfonylacetamide.
| Compound Name | (2E)-2-methoxyimino-N-[6-oxo-6-[2-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]hexyl]sulfonylacetamide |
|---|---|
| PubChem CID | 167867328 |
| Molecular Formula | C20H31N5O7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (2E)-2-methoxyimino-N-[6-oxo-6-[2-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]piperidin-1-yl]hexyl]sulfonylacetamide |
| SMILES | CO/N=C/C(=O)NS(=O)(=O)CCCCCC(=O)N1CCCCC1c1nnc([C@H]2CCCO2)o1 |
| InChI | InChI=1S/C20H31N5O7S/c1-30-21-14-17(26)24-33(28,29)13-6-2-3-10-18(27)25-11-5-4-8-15(25)19-22-23-20(32-19)16-9-7-12-31-16/h14-16H,2-13H2,1H3,(H,24,26)/b21-14+/t15?,16-/m1/s1 |
| InChIKey | GYNSMPIVWIUUSC-NNQXBJFGSA-N |
| XLogP | 1.61 |
| TPSA | 153.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|