C11H16N2O2S — CID 167867492
(4aR,8aR)-4-(4-methyl-1,3-thiazol-2-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[4,3-b][1,4]oxazine (PubChem CID 167867492) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is (4aR,8aR)-4-(4-methyl-1,3-thiazol-2-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[4,3-b][1,4]oxazine.
| Compound Name | (4aR,8aR)-4-(4-methyl-1,3-thiazol-2-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 167867492 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (4aR,8aR)-4-(4-methyl-1,3-thiazol-2-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[4,3-b][1,4]oxazine |
| SMILES | Cc1csc(N2CCO[C@@H]3CCOC[C@H]32)n1 |
| InChI | InChI=1S/C11H16N2O2S/c1-8-7-16-11(12-8)13-3-5-15-10-2-4-14-6-9(10)13/h7,9-10H,2-6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | KLGQJYAURKTVST-NXEZZACHSA-N |
| XLogP | 1.45 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |