C18H21FN6 — CID 167867635
N-[[5-(7-fluoro-2-methylindazol-5-yl)pyrazin-2-yl]methyl]-N-methylpyrrolidin-3-amine (PubChem CID 167867635) has the molecular formula C18H21FN6 and a molecular weight of 340.41 g/mol. Its IUPAC name is N-[[5-(7-fluoro-2-methylindazol-5-yl)pyrazin-2-yl]methyl]-N-methylpyrrolidin-3-amine.
| Compound Name | N-[[5-(7-fluoro-2-methylindazol-5-yl)pyrazin-2-yl]methyl]-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 167867635 |
| Molecular Formula | C18H21FN6 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[[5-(7-fluoro-2-methylindazol-5-yl)pyrazin-2-yl]methyl]-N-methylpyrrolidin-3-amine |
| SMILES | CN(Cc1cnc(-c2cc(F)c3nn(C)cc3c2)cn1)C1CCNC1 |
| InChI | InChI=1S/C18H21FN6/c1-24(15-3-4-20-8-15)11-14-7-22-17(9-21-14)12-5-13-10-25(2)23-18(13)16(19)6-12/h5-7,9-10,15,20H,3-4,8,11H2,1-2H3 |
| InChIKey | PLYWLFDIWWROSF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |