About 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol
3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol (PubChem CID 16786774) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol.
Molecular Properties
| Compound Name | 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol |
| PubChem CID | 16786774 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol |
| SMILES | NCC(c1cccc(O)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H20N2O/c18-11-17(14-6-3-7-16(20)10-14)19-9-8-13-4-1-2-5-15(13)12-19/h1-7,10,17,20H,8-9,11-12,18H2 |
| InChIKey | NYVNFVUSTUODCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol?
The IUPAC name of 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol (CID 16786774) is 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol.
What is the SMILES notation for 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol?
The canonical SMILES for 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol is NCC(c1cccc(O)c1)N1CCc2ccccc2C1.
What is the InChIKey of 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol?
The InChIKey is NYVNFVUSTUODCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c18-11-17(14-6-3-7-16(20)10-14)19-9-8-13-4-1-2-5-15(13)12-19/h1-7,10,17,20H,8-9,11-12,18H2.
What are the key properties of 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol?
3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol has a molecular weight of 268.36 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-amino-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenol is sourced from PubChem (CID 16786774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).