About 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one
6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one (PubChem CID 167867873) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one.
Molecular Properties
| Compound Name | 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one |
| PubChem CID | 167867873 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one |
| SMILES | O=C1CCCC(c2ccc(OCCc3cscn3)cc2)N1 |
| InChI | InChI=1S/C16H18N2O2S/c19-16-3-1-2-15(18-16)12-4-6-14(7-5-12)20-9-8-13-10-21-11-17-13/h4-7,10-11,15H,1-3,8-9H2,(H,18,19) |
| InChIKey | QZXSDPUTCREVIH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one?
The IUPAC name of 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one (CID 167867873) is 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one.
What is the SMILES notation for 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one?
The canonical SMILES for 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one is O=C1CCCC(c2ccc(OCCc3cscn3)cc2)N1.
What is the InChIKey of 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one?
The InChIKey is QZXSDPUTCREVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c19-16-3-1-2-15(18-16)12-4-6-14(7-5-12)20-9-8-13-10-21-11-17-13/h4-7,10-11,15H,1-3,8-9H2,(H,18,19).
What are the key properties of 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one?
6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one has a molecular weight of 302.40 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[2-(1,3-thiazol-4-yl)ethoxy]phenyl]piperidin-2-one is sourced from PubChem (CID 167867873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).