C21H22Cl2N6O4 — CID 167868057
4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4-dimethyl-1,3-oxazole-5-carbonyl)-1,4,7-triazecan-8-one (PubChem CID 167868057) has the molecular formula C21H22Cl2N6O4 and a molecular weight of 493.35 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4-dimethyl-1,3-oxazole-5-carbonyl)-1,4,7-triazecan-8-one.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4-dimethyl-1,3-oxazole-5-carbonyl)-1,4,7-triazecan-8-one |
|---|---|
| PubChem CID | 167868057 |
| Molecular Formula | C21H22Cl2N6O4 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4-dimethyl-1,3-oxazole-5-carbonyl)-1,4,7-triazecan-8-one |
| SMILES | Cc1nc(C)c(C(=O)N2CCC(=O)NCCN(c3nc(-c4cc(Cl)cc(Cl)c4)no3)CC2)o1 |
| InChI | InChI=1S/C21H22Cl2N6O4/c1-12-18(32-13(2)25-12)20(31)28-5-3-17(30)24-4-6-29(8-7-28)21-26-19(27-33-21)14-9-15(22)11-16(23)10-14/h9-11H,3-8H2,1-2H3,(H,24,30) |
| InChIKey | XWKVIXQNQAPPCG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |