C11H14N4O — CID 167868077
1-(5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)azetidin-3-ol (PubChem CID 167868077) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)azetidin-3-ol.
| Compound Name | 1-(5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)azetidin-3-ol |
|---|---|
| PubChem CID | 167868077 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-(5-ethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)azetidin-3-ol |
| SMILES | CCc1c[nH]c2ncnc(N3CC(O)C3)c12 |
| InChI | InChI=1S/C11H14N4O/c1-2-7-3-12-10-9(7)11(14-6-13-10)15-4-8(16)5-15/h3,6,8,16H,2,4-5H2,1H3,(H,12,13,14) |
| InChIKey | VPPBKAGINGFCTH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |