C24H29N5O3S — CID 167868090
N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]oxamide (PubChem CID 167868090) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]oxamide.
| Compound Name | N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]oxamide |
|---|---|
| PubChem CID | 167868090 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N'-(2-ethyl-1-thiophen-2-ylbutyl)-N-[3-(2-pyrazol-1-ylpropanoylamino)phenyl]oxamide |
| SMILES | CCC(CC)C(NC(=O)C(=O)Nc1cccc(NC(=O)C(C)n2cccn2)c1)c1cccs1 |
| InChI | InChI=1S/C24H29N5O3S/c1-4-17(5-2)21(20-11-7-14-33-20)28-24(32)23(31)27-19-10-6-9-18(15-19)26-22(30)16(3)29-13-8-12-25-29/h6-17,21H,4-5H2,1-3H3,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | WCWAMJDFWJKNCD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|