C14H9BrN4O4S — CID 167868329
N-[[5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitrothiophene-3-carboxamide (PubChem CID 167868329) has the molecular formula C14H9BrN4O4S and a molecular weight of 409.22 g/mol. Its IUPAC name is N-[[5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitrothiophene-3-carboxamide.
| Compound Name | N-[[5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitrothiophene-3-carboxamide |
|---|---|
| PubChem CID | 167868329 |
| Molecular Formula | C14H9BrN4O4S |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | N-[[5-(3-bromophenyl)-1,2,4-oxadiazol-3-yl]methyl]-5-nitrothiophene-3-carboxamide |
| SMILES | O=C(NCc1noc(-c2cccc(Br)c2)n1)c1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9BrN4O4S/c15-10-3-1-2-8(4-10)14-17-11(18-23-14)6-16-13(20)9-5-12(19(21)22)24-7-9/h1-5,7H,6H2,(H,16,20) |
| InChIKey | IBLQPDWRBARAJE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|