C17H15F2N5O3 — CID 167868692
(3aS,6aR)-5-[1-(3,4-difluorophenyl)-5-methyltriazole-4-carbonyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 167868692) has the molecular formula C17H15F2N5O3 and a molecular weight of 375.34 g/mol. Its IUPAC name is (3aS,6aR)-5-[1-(3,4-difluorophenyl)-5-methyltriazole-4-carbonyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | (3aS,6aR)-5-[1-(3,4-difluorophenyl)-5-methyltriazole-4-carbonyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 167868692 |
| Molecular Formula | C17H15F2N5O3 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (3aS,6aR)-5-[1-(3,4-difluorophenyl)-5-methyltriazole-4-carbonyl]-2-methyl-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | Cc1c(C(=O)N2C[C@@H]3C(=O)N(C)C(=O)[C@@H]3C2)nnn1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H15F2N5O3/c1-8-14(20-21-24(8)9-3-4-12(18)13(19)5-9)17(27)23-6-10-11(7-23)16(26)22(2)15(10)25/h3-5,10-11H,6-7H2,1-2H3/t10-,11+ |
| InChIKey | TVOUBFHTWJTNND-PHIMTYICSA-N |
| XLogP | 0.54 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|