C18H11BrN4O3S2 — CID 167868927
2-(1,3-benzodioxol-5-yl)-N'-(6-bromo-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carbohydrazide (PubChem CID 167868927) has the molecular formula C18H11BrN4O3S2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N'-(6-bromo-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N'-(6-bromo-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 167868927 |
| Molecular Formula | C18H11BrN4O3S2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 473.95 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N'-(6-bromo-1,3-benzothiazol-2-yl)-1,3-thiazole-5-carbohydrazide |
| SMILES | O=C(NNc1nc2ccc(Br)cc2s1)c1cnc(-c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C18H11BrN4O3S2/c19-10-2-3-11-14(6-10)28-18(21-11)23-22-16(24)15-7-20-17(27-15)9-1-4-12-13(5-9)26-8-25-12/h1-7H,8H2,(H,21,23)(H,22,24) |
| InChIKey | YILNUKQGLKWRTO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|