About (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate
(1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate (PubChem CID 167869311) has the molecular formula C27H26N2O5S
and a molecular weight of 490.58 g/mol. Its IUPAC name is (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate.
Molecular Properties
| Compound Name | (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate |
| PubChem CID | 167869311 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate |
| SMILES | Cc1cc2cc(OCc3ccc(OS(=O)(=O)Oc4ccc5c(c4)cc(C)n5C)cc3)ccc2n1C |
| InChI | InChI=1S/C27H26N2O5S/c1-18-13-21-15-24(9-11-26(21)28(18)3)32-17-20-5-7-23(8-6-20)33-35(30,31)34-25-10-12-27-22(16-25)14-19(2)29(27)4/h5-16H,17H2,1-4H3 |
| InChIKey | PZDCSOPWRODCFP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate?
The IUPAC name of (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate (CID 167869311) is (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate.
What is the SMILES notation for (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate?
The canonical SMILES for (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate is Cc1cc2cc(OCc3ccc(OS(=O)(=O)Oc4ccc5c(c4)cc(C)n5C)cc3)ccc2n1C.
What is the InChIKey of (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate?
The InChIKey is PZDCSOPWRODCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O5S/c1-18-13-21-15-24(9-11-26(21)28(18)3)32-17-20-5-7-23(8-6-20)33-35(30,31)34-25-10-12-27-22(16-25)14-19(2)29(27)4/h5-16H,17H2,1-4H3.
What are the key properties of (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate?
(1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate has a molecular weight of 490.58 g/mol, XLogP of 5.57, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylindol-5-yl) [4-[(1,2-dimethylindol-5-yl)oxymethyl]phenyl] sulfate is sourced from PubChem (CID 167869311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).