C15H18ClN5O2 — CID 167869461
N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide (PubChem CID 167869461) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167869461 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-6-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide |
| SMILES | CC1Cn2nc(C(=O)NCCOc3ccc(Cl)cn3)cc2CN1 |
| InChI | InChI=1S/C15H18ClN5O2/c1-10-9-21-12(8-18-10)6-13(20-21)15(22)17-4-5-23-14-3-2-11(16)7-19-14/h2-3,6-7,10,18H,4-5,8-9H2,1H3,(H,17,22) |
| InChIKey | VMOTWUGTMFQLPH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|