C14H16N4O2 — CID 16787006
N-[3-(aminomethyl)phenyl]-3-(2-oxopyrimidin-1-yl)propanamide (PubChem CID 16787006) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-3-(2-oxopyrimidin-1-yl)propanamide.
| Compound Name | N-[3-(aminomethyl)phenyl]-3-(2-oxopyrimidin-1-yl)propanamide |
|---|---|
| PubChem CID | 16787006 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-3-(2-oxopyrimidin-1-yl)propanamide |
| SMILES | NCc1cccc(NC(=O)CCn2cccnc2=O)c1 |
| InChI | InChI=1S/C14H16N4O2/c15-10-11-3-1-4-12(9-11)17-13(19)5-8-18-7-2-6-16-14(18)20/h1-4,6-7,9H,5,8,10,15H2,(H,17,19) |
| InChIKey | BQKNZMWTOJTRLU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |