C21H16Cl2N4O2 — CID 167871523
1-[1-(2,6-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-2,2a,3,4-tetrahydrobenzo[cd]indol-5-one (PubChem CID 167871523) has the molecular formula C21H16Cl2N4O2 and a molecular weight of 427.29 g/mol. Its IUPAC name is 1-[1-(2,6-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-2,2a,3,4-tetrahydrobenzo[cd]indol-5-one.
| Compound Name | 1-[1-(2,6-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-2,2a,3,4-tetrahydrobenzo[cd]indol-5-one |
|---|---|
| PubChem CID | 167871523 |
| Molecular Formula | C21H16Cl2N4O2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-[1-(2,6-dichlorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]-2,2a,3,4-tetrahydrobenzo[cd]indol-5-one |
| SMILES | Cc1nc(C(=O)N2CC3CCC(=O)c4cccc2c43)nn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H16Cl2N4O2/c1-11-24-20(25-27(11)19-14(22)5-3-6-15(19)23)21(29)26-10-12-8-9-17(28)13-4-2-7-16(26)18(12)13/h2-7,12H,8-10H2,1H3 |
| InChIKey | OCUQXUKUZCFGLG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |