About 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate
2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate (PubChem CID 167872200) has the molecular formula C20H23F2NO3
and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate |
| PubChem CID | 167872200 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate |
| SMILES | CC1(C)CCC(F)(F)CC1C(=O)OCCOc1ccnc2ccccc12 |
| InChI | InChI=1S/C20H23F2NO3/c1-19(2)8-9-20(21,22)13-15(19)18(24)26-12-11-25-17-7-10-23-16-6-4-3-5-14(16)17/h3-7,10,15H,8-9,11-13H2,1-2H3 |
| InChIKey | HZPHIIQNTJKTDL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate?
The IUPAC name of 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate (CID 167872200) is 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate is CC1(C)CCC(F)(F)CC1C(=O)OCCOc1ccnc2ccccc12.
What is the InChIKey of 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate?
The InChIKey is HZPHIIQNTJKTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2NO3/c1-19(2)8-9-20(21,22)13-15(19)18(24)26-12-11-25-17-7-10-23-16-6-4-3-5-14(16)17/h3-7,10,15H,8-9,11-13H2,1-2H3.
What are the key properties of 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate?
2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate has a molecular weight of 363.40 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-4-yloxyethyl 5,5-difluoro-2,2-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 167872200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).