C19H20N2O5 — CID 167873858
cis-(1R,3S)-5-(quinolin-3-ylmethylcarbamoyl)cyclohexane-1,3-dicarboxylic acid (PubChem CID 167873858) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is cis-(1R,3S)-5-(quinolin-3-ylmethylcarbamoyl)cyclohexane-1,3-dicarboxylic acid.
| Compound Name | cis-(1R,3S)-5-(quinolin-3-ylmethylcarbamoyl)cyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 167873858 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | cis-(1R,3S)-5-(quinolin-3-ylmethylcarbamoyl)cyclohexane-1,3-dicarboxylic acid |
| SMILES | O=C(NCc1cnc2ccccc2c1)C1C[C@@H](C(=O)O)C[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C19H20N2O5/c22-17(13-6-14(18(23)24)8-15(7-13)19(25)26)21-10-11-5-12-3-1-2-4-16(12)20-9-11/h1-5,9,13-15H,6-8,10H2,(H,21,22)(H,23,24)(H,25,26)/t13?,14-,15+ |
| InChIKey | YKCLMYZGKHTJBL-GOOCMWNKSA-N |
| XLogP | 2.05 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |