About 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride
2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride (PubChem CID 167874068) has the molecular formula C8H13ClN4O3
and a molecular weight of 248.67 g/mol. Its IUPAC name is 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride |
| PubChem CID | 167874068 |
| Molecular Formula | C8H13ClN4O3 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(=O)NCC(=O)NCc1ccon1 |
| InChI | InChI=1S/C8H12N4O3.ClH/c9-3-7(13)11-5-8(14)10-4-6-1-2-15-12-6;/h1-2H,3-5,9H2,(H,10,14)(H,11,13);1H |
| InChIKey | HCYLPZYVDAEFFX-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride?
The IUPAC name of 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride (CID 167874068) is 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride.
What is the SMILES notation for 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride?
The canonical SMILES for 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride is Cl.NCC(=O)NCC(=O)NCc1ccon1.
What is the InChIKey of 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride?
The InChIKey is HCYLPZYVDAEFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3.ClH/c9-3-7(13)11-5-8(14)10-4-6-1-2-15-12-6;/h1-2H,3-5,9H2,(H,10,14)(H,11,13);1H.
What are the key properties of 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride?
2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride has a molecular weight of 248.67 g/mol, XLogP of -1.21, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-(1,2-oxazol-3-ylmethylamino)-2-oxoethyl]acetamide;hydrochloride is sourced from PubChem (CID 167874068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).