C20H25N7O2 — CID 167874317
N-[3-[3-(1-methylindol-3-yl)-5-(3-oxopiperazin-1-yl)-1,2,4-triazol-4-yl]propyl]acetamide (PubChem CID 167874317) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is N-[3-[3-(1-methylindol-3-yl)-5-(3-oxopiperazin-1-yl)-1,2,4-triazol-4-yl]propyl]acetamide.
| Compound Name | N-[3-[3-(1-methylindol-3-yl)-5-(3-oxopiperazin-1-yl)-1,2,4-triazol-4-yl]propyl]acetamide |
|---|---|
| PubChem CID | 167874317 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[3-[3-(1-methylindol-3-yl)-5-(3-oxopiperazin-1-yl)-1,2,4-triazol-4-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCn1c(-c2cn(C)c3ccccc23)nnc1N1CCNC(=O)C1 |
| InChI | InChI=1S/C20H25N7O2/c1-14(28)21-8-5-10-27-19(16-12-25(2)17-7-4-3-6-15(16)17)23-24-20(27)26-11-9-22-18(29)13-26/h3-4,6-7,12H,5,8-11,13H2,1-2H3,(H,21,28)(H,22,29) |
| InChIKey | ZZCYDNSPQGBFFZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|