C13H15N5O2 — CID 167874786
2-[cyclopropyl-[(2-methylpyrazol-3-yl)methyl]amino]pyrimidine-4-carboxylic acid (PubChem CID 167874786) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-[cyclopropyl-[(2-methylpyrazol-3-yl)methyl]amino]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[cyclopropyl-[(2-methylpyrazol-3-yl)methyl]amino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 167874786 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-[cyclopropyl-[(2-methylpyrazol-3-yl)methyl]amino]pyrimidine-4-carboxylic acid |
| SMILES | Cn1nccc1CN(c1nccc(C(=O)O)n1)C1CC1 |
| InChI | InChI=1S/C13H15N5O2/c1-17-10(4-7-15-17)8-18(9-2-3-9)13-14-6-5-11(16-13)12(19)20/h4-7,9H,2-3,8H2,1H3,(H,19,20) |
| InChIKey | WJMHGFWMIZRNJA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |