C17H18N2O6 — CID 167875070
methyl 9-(3-formyl-4-hydroxybenzoyl)-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-3-carboxylate (PubChem CID 167875070) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is methyl 9-(3-formyl-4-hydroxybenzoyl)-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-3-carboxylate.
| Compound Name | methyl 9-(3-formyl-4-hydroxybenzoyl)-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 167875070 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | methyl 9-(3-formyl-4-hydroxybenzoyl)-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=NOC2(CCCN(C(=O)c3ccc(O)c(C=O)c3)C2)C1 |
| InChI | InChI=1S/C17H18N2O6/c1-24-16(23)13-8-17(25-18-13)5-2-6-19(10-17)15(22)11-3-4-14(21)12(7-11)9-20/h3-4,7,9,21H,2,5-6,8,10H2,1H3 |
| InChIKey | OONSMMLORKWMED-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|