C15H13BrN2O2 — CID 167875346
[3-[(6-bromo-1,2-benzoxazol-3-yl)methoxy]phenyl]methanamine (PubChem CID 167875346) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is [3-[(6-bromo-1,2-benzoxazol-3-yl)methoxy]phenyl]methanamine.
| Compound Name | [3-[(6-bromo-1,2-benzoxazol-3-yl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 167875346 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | [3-[(6-bromo-1,2-benzoxazol-3-yl)methoxy]phenyl]methanamine |
| SMILES | NCc1cccc(OCc2noc3cc(Br)ccc23)c1 |
| InChI | InChI=1S/C15H13BrN2O2/c16-11-4-5-13-14(18-20-15(13)7-11)9-19-12-3-1-2-10(6-12)8-17/h1-7H,8-9,17H2 |
| InChIKey | MMAGPHKVCZCDCM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |