C17H22N4O2S — CID 167875569
4-methoxy-N-[1-(1,3,4-thiadiazol-2-ylmethyl)azepan-4-yl]benzamide (PubChem CID 167875569) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 4-methoxy-N-[1-(1,3,4-thiadiazol-2-ylmethyl)azepan-4-yl]benzamide.
| Compound Name | 4-methoxy-N-[1-(1,3,4-thiadiazol-2-ylmethyl)azepan-4-yl]benzamide |
|---|---|
| PubChem CID | 167875569 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-methoxy-N-[1-(1,3,4-thiadiazol-2-ylmethyl)azepan-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC2CCCN(Cc3nncs3)CC2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-23-15-6-4-13(5-7-15)17(22)19-14-3-2-9-21(10-8-14)11-16-20-18-12-24-16/h4-7,12,14H,2-3,8-11H2,1H3,(H,19,22) |
| InChIKey | KKSYSRIWEWGMIC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |