C17H20N2O3 — CID 167876645
3-amino-4-[[1-(3-methoxyphenyl)cyclopentyl]methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 167876645) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-amino-4-[[1-(3-methoxyphenyl)cyclopentyl]methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[[1-(3-methoxyphenyl)cyclopentyl]methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 167876645 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-amino-4-[[1-(3-methoxyphenyl)cyclopentyl]methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | COc1cccc(C2(CNc3c(N)c(=O)c3=O)CCCC2)c1 |
| InChI | InChI=1S/C17H20N2O3/c1-22-12-6-4-5-11(9-12)17(7-2-3-8-17)10-19-14-13(18)15(20)16(14)21/h4-6,9,19H,2-3,7-8,10,18H2,1H3 |
| InChIKey | SSMVAUQESHMEEN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|