C16H23N5O2 — CID 167876750
1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonylamino)urea (PubChem CID 167876750) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonylamino)urea.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonylamino)urea |
|---|---|
| PubChem CID | 167876750 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonylamino)urea |
| SMILES | O=C(NNC(=O)c1cn2c(n1)CCCC2)N[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C16H23N5O2/c22-15(13-9-21-6-2-1-3-14(21)17-13)19-20-16(23)18-12-8-10-4-5-11(12)7-10/h9-12H,1-8H2,(H,19,22)(H2,18,20,23)/t10-,11+,12-/m0/s1 |
| InChIKey | KGRGCJVVIBNKBL-TUAOUCFPSA-N |
| XLogP | 1.35 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|