C22H28F2N6O2 — CID 167877881
2-[4-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]carbamoylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 167877881) has the molecular formula C22H28F2N6O2 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[4-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]carbamoylamino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]carbamoylamino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 167877881 |
| Molecular Formula | C22H28F2N6O2 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-[4-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]carbamoylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)NC2CCc3nc(-c4ccc(F)cc4F)cn3C2)CC1 |
| InChI | InChI=1S/C22H28F2N6O2/c1-25-21(31)13-29-8-6-15(7-9-29)26-22(32)27-16-3-5-20-28-19(12-30(20)11-16)17-4-2-14(23)10-18(17)24/h2,4,10,12,15-16H,3,5-9,11,13H2,1H3,(H,25,31)(H2,26,27,32) |
| InChIKey | ATBQTMJYMWKMPL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |