C12H18F3N3O4S3 — CID 167878066
ethyl 2-[2-(2-aminoethyldisulfanyl)ethylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 167878066) has the molecular formula C12H18F3N3O4S3 and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl 2-[2-(2-aminoethyldisulfanyl)ethylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[2-(2-aminoethyldisulfanyl)ethylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167878066 |
| Molecular Formula | C12H18F3N3O4S3 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | ethyl 2-[2-(2-aminoethyldisulfanyl)ethylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1cnc(NCCSSCCN)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H17N3O2S3.C2HF3O2/c1-2-15-9(14)8-7-13-10(18-8)12-4-6-17-16-5-3-11;3-2(4,5)1(6)7/h7H,2-6,11H2,1H3,(H,12,13);(H,6,7) |
| InChIKey | FBDXWEXFKCZNCX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|