About N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide
N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide (PubChem CID 167878417) has the molecular formula C13H18Cl2N2O2S
and a molecular weight of 337.27 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide |
| PubChem CID | 167878417 |
| Molecular Formula | C13H18Cl2N2O2S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC(N)C2(C)C)c(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2S/c1-7-4-5-8(12(15)11(7)14)20(18,19)17-10-6-9(16)13(10,2)3/h4-5,9-10,17H,6,16H2,1-3H3 |
| InChIKey | WJYHSOVHFPVZFO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide?
The IUPAC name of N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide (CID 167878417) is N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide?
The canonical SMILES for N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NC2CC(N)C2(C)C)c(Cl)c1Cl.
What is the InChIKey of N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide?
The InChIKey is WJYHSOVHFPVZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N2O2S/c1-7-4-5-8(12(15)11(7)14)20(18,19)17-10-6-9(16)13(10,2)3/h4-5,9-10,17H,6,16H2,1-3H3.
What are the key properties of N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide?
N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide has a molecular weight of 337.27 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylcyclobutyl)-2,3-dichloro-4-methylbenzenesulfonamide is sourced from PubChem (CID 167878417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).