C11H10Cl2N2O4S — CID 167878821
6,7-dichloro-3-(2-methylsulfonylethyl)-1H-quinazoline-2,4-dione (PubChem CID 167878821) has the molecular formula C11H10Cl2N2O4S and a molecular weight of 337.18 g/mol. Its IUPAC name is 6,7-dichloro-3-(2-methylsulfonylethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 6,7-dichloro-3-(2-methylsulfonylethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 167878821 |
| Molecular Formula | C11H10Cl2N2O4S |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 6,7-dichloro-3-(2-methylsulfonylethyl)-1H-quinazoline-2,4-dione |
| SMILES | CS(=O)(=O)CCn1c(=O)[nH]c2cc(Cl)c(Cl)cc2c1=O |
| InChI | InChI=1S/C11H10Cl2N2O4S/c1-20(18,19)3-2-15-10(16)6-4-7(12)8(13)5-9(6)14-11(15)17/h4-5H,2-3H2,1H3,(H,14,17) |
| InChIKey | XQXWBXNSWXGQCF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |