C15H21F3N4O — CID 167878888
(E)-4,4,4-trifluoro-1-[4-[(3-propan-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidin-1-yl]but-2-en-1-one (PubChem CID 167878888) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-1-[4-[(3-propan-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4,4,4-trifluoro-1-[4-[(3-propan-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 167878888 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (E)-4,4,4-trifluoro-1-[4-[(3-propan-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidin-1-yl]but-2-en-1-one |
| SMILES | CC(C)c1n[nH]c(CC2CCN(C(=O)/C=C/C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C15H21F3N4O/c1-10(2)14-19-12(20-21-14)9-11-4-7-22(8-5-11)13(23)3-6-15(16,17)18/h3,6,10-11H,4-5,7-9H2,1-2H3,(H,19,20,21)/b6-3+ |
| InChIKey | JNTNIXVJGFZUHM-ZZXKWVIFSA-N |
| XLogP | 2.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|