About 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide
2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide (PubChem CID 167879235) has the molecular formula C16H20ClN5O
and a molecular weight of 333.82 g/mol. Its IUPAC name is 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide |
| PubChem CID | 167879235 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(Nc2ccc3cc(Cl)cnc3n2)CC1 |
| InChI | InChI=1S/C16H20ClN5O/c1-18-15(23)10-22-6-4-13(5-7-22)20-14-3-2-11-8-12(17)9-19-16(11)21-14/h2-3,8-9,13H,4-7,10H2,1H3,(H,18,23)(H,19,20,21) |
| InChIKey | VENTVRXEMAFKTN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide?
The IUPAC name of 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide (CID 167879235) is 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide.
What is the SMILES notation for 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide?
The canonical SMILES for 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide is CNC(=O)CN1CCC(Nc2ccc3cc(Cl)cnc3n2)CC1.
What is the InChIKey of 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide?
The InChIKey is VENTVRXEMAFKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN5O/c1-18-15(23)10-22-6-4-13(5-7-22)20-14-3-2-11-8-12(17)9-19-16(11)21-14/h2-3,8-9,13H,4-7,10H2,1H3,(H,18,23)(H,19,20,21).
What are the key properties of 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide?
2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide has a molecular weight of 333.82 g/mol, XLogP of 1.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(6-chloro-1,8-naphthyridin-2-yl)amino]piperidin-1-yl]-N-methylacetamide is sourced from PubChem (CID 167879235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).