C19H16F3NO3S — CID 167880591
N-benzyl-N-(furan-2-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 167880591) has the molecular formula C19H16F3NO3S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-benzyl-N-(furan-2-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-benzyl-N-(furan-2-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167880591 |
| Molecular Formula | C19H16F3NO3S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-benzyl-N-(furan-2-ylmethyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C19H16F3NO3S/c20-19(21,22)17-10-4-5-11-18(17)27(24,25)23(14-16-9-6-12-26-16)13-15-7-2-1-3-8-15/h1-12H,13-14H2 |
| InChIKey | ZJZBYOAJZBNIOH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |