C20H27F2N5O — CID 167881223
1-(1-amino-4-methylpentan-2-yl)-3-[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea (PubChem CID 167881223) has the molecular formula C20H27F2N5O and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-(1-amino-4-methylpentan-2-yl)-3-[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea.
| Compound Name | 1-(1-amino-4-methylpentan-2-yl)-3-[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 167881223 |
| Molecular Formula | C20H27F2N5O |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 1-(1-amino-4-methylpentan-2-yl)-3-[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]urea |
| SMILES | CC(C)CC(CN)NC(=O)NC1CCc2nc(-c3ccc(F)cc3F)cn2C1 |
| InChI | InChI=1S/C20H27F2N5O/c1-12(2)7-15(9-23)25-20(28)24-14-4-6-19-26-18(11-27(19)10-14)16-5-3-13(21)8-17(16)22/h3,5,8,11-12,14-15H,4,6-7,9-10,23H2,1-2H3,(H2,24,25,28) |
| InChIKey | HLTBLMWIUDSRDE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |